CAS 34650-68-5 appears in our catalog under these names: Prasugrel Impurity H, 2-Bromo-1-cyclopropyl-2-phenylethanone (>85%), 2-Bromo-1-cyclopropyl-2-phenylethanone. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 250mg, 500mg, 100mg.
2-bromo-1-cyclopropyl-2-phenylethanone (CAS 34650-68-5) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 2-bromo-1-cyclopropyl-2-phenylethanone. InChIKey: FOCQHQYRBCPPIP-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 2-bromo-1-cyclopropyl-2-phenylethanone |
| InChIKey | FOCQHQYRBCPPIP-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C(C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)