CAS 34658-66-7 appears in our catalog under these names: 2–(4–Bromophenyl)imidazo(1,2–a)pyridine, 2-(4-Bromophenyl)imidazo[1,2-a]pyridine, >98.0%(GC)(T), 2-(4-BROMOPHENYL)IMIDAZO(1,2-A)PYRIDINE&, 2-(4-Bromophenyl)imidazo[1,2-a]pyridine, 97%, 97%, 2-(4-BROMOPHENYL)IMIDAZO[1,2-A]PYRIDINE, 95%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
2-(4-bromophenyl)imidazo[1,2-a]pyridine (CAS 34658-66-7) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(4-bromophenyl)imidazo[1,2-a]pyridine. InChIKey: GRZUOGFRIHABDK-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)imidazo[1,2-a]pyridine |
| InChIKey | GRZUOGFRIHABDK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)