CAS 346721-50-4 appears in our catalog under these names: XS–060, XS-060, 98.67%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 50mg, 10mg, 100mg, 25mg, 5mg, 100 mg, 25 mg, 10 mg.
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxyphenyl)acetamide (CAS 346721-50-4) is a chemical compound with the molecular formula C20H18N2O3 and a molecular weight of 334.4 g/mol. IUPAC name: N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxyphenyl)acetamide. InChIKey: HGVXUENDHRTHPJ-FYJGNVAPSA-N.
| Molecular formula | C20H18N2O3 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxyphenyl)acetamide |
| InChIKey | HGVXUENDHRTHPJ-FYJGNVAPSA-N |
| SMILES | COC1=CC=C(C=C1)CC(=O)N/N=C/C2=C(C=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)