CAS 756520-51-1 is the registry number for 4-(6-Amino-5-benzyloxy-pyridin-3-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(6-amino-5-phenylmethoxy-3-pyridinyl)benzoate (CAS 756520-51-1) is a chemical compound with the molecular formula C20H18N2O3 and a molecular weight of 334.4 g/mol. IUPAC name: methyl 4-(6-amino-5-phenylmethoxy-3-pyridinyl)benzoate. InChIKey: XGMBFMPFJJWCAP-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O3 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl 4-(6-amino-5-phenylmethoxy-3-pyridinyl)benzoate |
| InChIKey | XGMBFMPFJJWCAP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=C(N=C2)N)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)