CAS 956923-54-9 is the registry number for (3R)-2-Acetyl-1-phenyl-2,3,4,9-tetrahydro-1h-beta-carboline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3R)-2-acetyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (CAS 956923-54-9) is a chemical compound with the molecular formula C20H18N2O3 and a molecular weight of 334.4 g/mol. IUPAC name: (3R)-2-acetyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid. InChIKey: RKISQQCZJAUBPR-DUSLRRAJSA-N.
| Molecular formula | C20H18N2O3 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (3R)-2-acetyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | RKISQQCZJAUBPR-DUSLRRAJSA-N |
| SMILES | CC(=O)N1[C@H](CC2=C(C1C3=CC=CC=C3)NC4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)