Products 34691-02-6
CAS 34691-02-6 appears in our catalog under these names: Cephalothin Impurity B,Cefalotin sodium EP Impurity A, Cefalotin EP Impurity A, Cefalotin Impurity 1(Cefalotin EP Impurity A), Deacetoxycephalothin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-3-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 34691-02-6) is a chemical compound with the molecular formula C14H14N2O4S2 and a molecular weight of 338.4 g/mol. IUPAC name: (6R,7R)-3-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: KCCXIEAFHKKZLW-ZWNOBZJWSA-N.
| Molecular formula | C14H14N2O4S2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (6R,7R)-3-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | KCCXIEAFHKKZLW-ZWNOBZJWSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CC3=CC=CS3)SC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Deacetoxycephalothin, Cefalotin EP Impurity A, orb1986223, 7beta-(2-Thienylacetamido)desacetoxycephalosporanic acid, KCCXIEAFHKKZLW-ZWNOBZJWSA-N, Cephalothin Impurity B;Cefalotin sodium EP Impurity A, Cephalothin Impurity B; Cefalotin Sodium EP Impurity A, (6R,7R)-3-methyl-7-(2-thienyl) acetamidoceph-3-em-4-carboxylic acid