CAS 914636-39-8 is the registry number for 2-Amino-1-aza-3-((4-methylphenyl)sulfonyl)prop-1-enyl thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
[(Z)-[1-amino-2-(4-methylphenyl)sulfonylethylidene]amino] thiophene-2-carboxylate (CAS 914636-39-8) is a chemical compound with the molecular formula C14H14N2O4S2 and a molecular weight of 338.4 g/mol. IUPAC name: [(Z)-[1-amino-2-(4-methylphenyl)sulfonylethylidene]amino] thiophene-2-carboxylate. InChIKey: AJMFJMFDZSBLJU-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | [(Z)-[1-amino-2-(4-methylphenyl)sulfonylethylidene]amino] thiophene-2-carboxylate |
| InChIKey | AJMFJMFDZSBLJU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C/C(=N/OC(=O)C2=CC=CS2)/N |
Computed by PubChem (NCBI)