CAS 919015-73-9 is the registry number for 4-(N-(3-Acetylphenyl)sulfamoyl)-5-methylthiophene-2-carboxamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3-acetylphenyl)sulfamoyl]-5-methylthiophene-2-carboxamide (CAS 919015-73-9) is a chemical compound with the molecular formula C14H14N2O4S2 and a molecular weight of 338.4 g/mol. IUPAC name: 4-[(3-acetylphenyl)sulfamoyl]-5-methylthiophene-2-carboxamide. InChIKey: PGXBKCPFGKCYTQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 4-[(3-acetylphenyl)sulfamoyl]-5-methylthiophene-2-carboxamide |
| InChIKey | PGXBKCPFGKCYTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(S1)C(=O)N)S(=O)(=O)NC2=CC=CC(=C2)C(=O)C |
Computed by PubChem (NCBI)