CAS 34701-53-6 appears in our catalog under these names: Insencol Acetate, Incensole acetate, Incensole Acetate, Incensole Acetate 99%, (1R,2S,5E,9E,12S)-12-Isopropyl-1,5,9-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl acetate, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Chemat, Biosynth. Available pack sizes: 100mg, 2mg, 1mg, 10mg, 25mg, 5mg, 50mg, 250mg.
[(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] acetate (CAS 34701-53-6) is a chemical compound with the molecular formula C22H36O3 and a molecular weight of 348.5 g/mol. IUPAC name: [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] acetate. InChIKey: HVBACKJYWZTKCA-XSLBTUIJSA-N.
| Molecular formula | C22H36O3 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] acetate |
| InChIKey | HVBACKJYWZTKCA-XSLBTUIJSA-N |
| SMILES | C/C/1=C\CC/C(=C/C[C@@]2(CC[C@@](O2)([C@H](CC1)OC(=O)C)C)C(C)C)/C |
Computed by PubChem (NCBI)