Products 4608-49-5
CAS 4608-49-5 appears in our catalog under these names: Larixyl Acetate, Larixol acetate, min. 95 %, 5 mg, Larixyl Acetate, >95% (HPLC), Larixyl acetate, 98%, Larixyl acetate/ 99.28% (existing batch purity). Offered by: GLPBio, Roth, TRC, AmBeed, TargetMol. Available pack sizes: 5mg, 500mg, 50mg, 10mg, 25mg, 10mM (in 1ml dmso), 100mg, 1mg.
[(1S,4S,4aR,8aS)-4-[(3S)-3-hydroxy-3-methylpent-4-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate (CAS 4608-49-5) is a chemical compound with the molecular formula C22H36O3 and a molecular weight of 348.5 g/mol. IUPAC name: [(1S,4S,4aR,8aS)-4-[(3S)-3-hydroxy-3-methylpent-4-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate. InChIKey: WCNCDVQMEQJFGH-TZWCSUAMSA-N.
| Molecular formula | C22H36O3 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | [(1S,4S,4aR,8aS)-4-[(3S)-3-hydroxy-3-methylpent-4-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
| InChIKey | WCNCDVQMEQJFGH-TZWCSUAMSA-N |
| SMILES | CC(=O)O[C@H]1CC(=C)[C@@H]([C@@]2([C@@H]1C(CCC2)(C)C)C)CC[C@@](C)(C=C)O |
Computed by PubChem (NCBI)