CAS 74034-56-3 appears in our catalog under these names: 9Alpha,11alpha-methylene-15s-hydroxy-11a-deoxy-11a-methylene-thromba-5z,13e-dien-1-oicacid, 95%, Carbocyclic Thromboxane A2, Carbocyclic Thromboxane A2. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 5mg, 1mg, 100μg, 500μg.
(Z)-7-[(2S,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (CAS 74034-56-3) is a chemical compound with the molecular formula C22H36O3 and a molecular weight of 348.5 g/mol. IUPAC name: (Z)-7-[(2S,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid. InChIKey: ZIWNJZLXPXFNGN-GXTQQWMXSA-N.
| Molecular formula | C22H36O3 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | (Z)-7-[(2S,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| InChIKey | ZIWNJZLXPXFNGN-GXTQQWMXSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CC2CC(C2)[C@@H]1C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)