CAS 347146-12-7 appears in our catalog under these names: 5-Bromoquinolin-2-amine, 95%, 5-Bromoquinolin-2-amine, 5-Bromoquinolin-2-amine 98%, 5-bromoquinolin-2-amine, 98%, 98%, 5-Bromoquinolin-2-amine, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 25g, 100mg, 5g, 10g, 50mg.
5-bromoquinolin-2-amine (CAS 347146-12-7) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 5-bromoquinolin-2-amine. InChIKey: KBQIVWNPOZQTTE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 5-bromoquinolin-2-amine |
| InChIKey | KBQIVWNPOZQTTE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C(=C1)Br |
Computed by PubChem (NCBI)