Products 34749-75-2
CAS 34749-75-2 appears in our catalog under these names: Acridine-d9, >95% (HPLC), Acridine D9, Acridine–d9. Offered by: TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 20mg, 2mg, 4mg, 10mg, 100mg.
1,2,3,4,5,6,7,8,9-nonadeuterioacridine (CAS 34749-75-2) is a chemical compound with the molecular formula C13H9N and a molecular weight of 188.27 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9-nonadeuterioacridine. InChIKey: DZBUGLKDJFMEHC-LOIXRAQWSA-N.
| Molecular formula | C13H9N |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9-nonadeuterioacridine |
| InChIKey | DZBUGLKDJFMEHC-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=N2)[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)