Products 3475-97-6
CAS 3475-97-6 is the registry number for Methyl 2-chloro-6-sulfamoylbenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-chloro-6-sulfamoylbenzoate (CAS 3475-97-6) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: methyl 2-chloro-6-sulfamoylbenzoate. InChIKey: ZRYDQFHTHDZUOI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | methyl 2-chloro-6-sulfamoylbenzoate |
| InChIKey | ZRYDQFHTHDZUOI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)