Products 347841-44-5
CAS 347841-44-5 appears in our catalog under these names: 2-Aminofluorene-d11, 98 atom % D, min 98% Chemical Purity, 2-Aminofluorene-d11, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 10 mg, 1 mg.
N,N,1,3,4,5,6,7,8,9,9-undecadeuteriofluoren-2-amine (CAS 347841-44-5) is a chemical compound with the molecular formula C13H11N and a molecular weight of 192.30 g/mol. IUPAC name: N,N,1,3,4,5,6,7,8,9,9-undecadeuteriofluoren-2-amine. InChIKey: CFRFHWQYWJMEJN-DCWZJRGXSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | N,N,1,3,4,5,6,7,8,9,9-undecadeuteriofluoren-2-amine |
| InChIKey | CFRFHWQYWJMEJN-DCWZJRGXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])N([2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)