Products 348088-68-6
CAS 348088-68-6 appears in our catalog under these names: Cefoperazone Impurity 19, Cefoperazone Impurity 9, (S)-2-(4-Ethyl-2,3-dioxopiperazine-1-carboxamido)-2-(4-hydroxyphenyl)acetic acid, 98%, Cefprozil Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid (CAS 348088-68-6) is a chemical compound with the molecular formula C15H17N3O6 and a molecular weight of 335.31 g/mol. IUPAC name: (2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid. InChIKey: IPARGUVYMOMVNU-NSHDSACASA-N.
| Molecular formula | C15H17N3O6 |
|---|---|
| Molecular weight | 335.31 g/mol |
| IUPAC name | (2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | IPARGUVYMOMVNU-NSHDSACASA-N |
| SMILES | CCN1CCN(C(=O)C1=O)C(=O)N[C@@H](C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)