CAS 79868-75-0 is the registry number for alpha-(((4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl)amino)-4-hydroxybenzeneacetic Acid. Offered by: TRC. Available pack sizes: 5g.
2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid (CAS 79868-75-0) is a chemical compound with the molecular formula C15H17N3O6 and a molecular weight of 335.31 g/mol. IUPAC name: 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid. InChIKey: IPARGUVYMOMVNU-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O6 |
|---|---|
| Molecular weight | 335.31 g/mol |
| IUPAC name | 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | IPARGUVYMOMVNU-UHFFFAOYSA-N |
| SMILES | CCN1CCN(C(=O)C1=O)C(=O)NC(C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)