CAS 7041-61-4 appears in our catalog under these names: 7-Hydroxy Mitomycin, Mitomycin Impurity 5(7-Hydroxy Mitomycin), 7-Demethyl Mitomycin A. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(13-hydroxy-7-methoxy-12-methyl-10,11-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),12-dien-8-yl)methyl carbamate (CAS 7041-61-4) is a chemical compound with the molecular formula C15H17N3O6 and a molecular weight of 335.31 g/mol. IUPAC name: (13-hydroxy-7-methoxy-12-methyl-10,11-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),12-dien-8-yl)methyl carbamate. InChIKey: WKYZYLKGCNBEMG-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O6 |
|---|---|
| Molecular weight | 335.31 g/mol |
| IUPAC name | (13-hydroxy-7-methoxy-12-methyl-10,11-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),12-dien-8-yl)methyl carbamate |
| InChIKey | WKYZYLKGCNBEMG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(C3(N2CC4C3N4)OC)COC(=O)N)C(=O)C1=O)O |
Computed by PubChem (NCBI)