CAS 348622-88-8 appears in our catalog under these names: Uk 383367, 95%, UK-383367/ 100%, UK 383367, UK 383367, UK-383367 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 25 mg, 100 mg, 5 mg.
5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide (CAS 348622-88-8) is a chemical compound with the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. IUPAC name: 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide. InChIKey: ARJCBSRIPGJMAD-LLVKDONJSA-N.
| Molecular formula | C15H24N4O4 |
|---|---|
| Molecular weight | 324.38 g/mol |
| IUPAC name | 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide |
| InChIKey | ARJCBSRIPGJMAD-LLVKDONJSA-N |
| SMILES | C1CCC(CC1)CCC[C@H](CC(=O)NO)C2=NC(=NO2)C(=O)N |
Computed by PubChem (NCBI)