Products 850080-13-6
CAS 850080-13-6 appears in our catalog under these names: (2,5-Dioxopyrrolidin-1-yl) 11-azidoundecanoate, 95%, (2,5–Dioxopyrrolidin–1–yl) 11–azidoundecanoate, 11-Azido-undecanoyl-OSu, 2, 5-Dioxo-1-pyrrolidinyl 11-azidoundecanoate 95%, 2,5-Dioxo-1-pyrrolidinyl 11-azidoundecanoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg, 5g, 100mg, 50mg, 1 g, 50 mg.
(2,5-dioxopyrrolidin-1-yl) 11-azidoundecanoate (CAS 850080-13-6) is a chemical compound with the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 11-azidoundecanoate. InChIKey: IVJGODXPMKXQTE-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O4 |
|---|---|
| Molecular weight | 324.38 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 11-azidoundecanoate |
| InChIKey | IVJGODXPMKXQTE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)