CAS 718632-47-4 is the registry number for 5-(tert-Butyl) 1-ethyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo(3,4-c)pyrazole-1,5-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-O-tert-butyl 1-O-ethyl 3-amino-6,6-dimethyl-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate (CAS 718632-47-4) is a chemical compound with the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. IUPAC name: 5-O-tert-butyl 1-O-ethyl 3-amino-6,6-dimethyl-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate. InChIKey: IJRZSSYHHCGXMC-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O4 |
|---|---|
| Molecular weight | 324.38 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-ethyl 3-amino-6,6-dimethyl-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate |
| InChIKey | IJRZSSYHHCGXMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=C(CN(C2(C)C)C(=O)OC(C)(C)C)C(=N1)N |
Computed by PubChem (NCBI)