CAS 349-81-5 appears in our catalog under these names: 2-{(3-(Trifluoromethyl)phenyl)amino}acetic acid, 2-((3-(Trifluoromethyl)phenyl)amino)acetic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
2-[3-(trifluoromethyl)anilino]acetic acid (CAS 349-81-5) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-[3-(trifluoromethyl)anilino]acetic acid. InChIKey: JUXDXJXSMIGCPK-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)anilino]acetic acid |
| InChIKey | JUXDXJXSMIGCPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)