Products 3493-12-7
CAS 3493-12-7 appears in our catalog under these names: DL-Methionine Methylsulfonium Chloride, >95% (HPLC), DL-Methionine Methylsulfonium Chloride, DL–Methionine methylsulfonium chloride, DL-Methionine Methylsulfonium Chloride, >99.0%(T), Vitamin U 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 10g, 50g, 5g, 10mg, 100mg.
(3-amino-3-carboxypropyl)-dimethylsulfanium chloride (CAS 3493-12-7) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (3-amino-3-carboxypropyl)-dimethylsulfanium chloride. InChIKey: MYGVPKMVGSXPCQ-UHFFFAOYSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (3-amino-3-carboxypropyl)-dimethylsulfanium chloride |
| InChIKey | MYGVPKMVGSXPCQ-UHFFFAOYSA-N |
| SMILES | C[S+](C)CCC(C(=O)O)N.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
DL-Methionine methylsulfonium chloride, Methionylmethylsulfonium chloride, Cabagin-U, VITAS-U, METHYLMETHIONINE CHLORIDE, DL-, MMSC, DL-Methionine methylsulfonium (chloride), (3-Amino-3-carboxypropyl)dimethylsulfonium Chloride, Methylmethionine sulfonium chloride, dl-, (3-amino-3-carboxypropyl)-dimethylsulfanium;chloride