Products 34950-11-3
CAS 34950-11-3 is the registry number for (2,5-Dichlorophenyl)-4-pyridinylmethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dichlorophenyl)-pyridin-4-ylmethanone (CAS 34950-11-3) is a chemical compound with the molecular formula C12H7Cl2NO and a molecular weight of 252.09 g/mol. IUPAC name: (2,5-dichlorophenyl)-pyridin-4-ylmethanone. InChIKey: VXBLNTLSDWPKGV-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-pyridin-4-ylmethanone |
| InChIKey | VXBLNTLSDWPKGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C2=CC=NC=C2)Cl |
Computed by PubChem (NCBI)