Products 80099-85-0
CAS 80099-85-0 is the registry number for (4-Chlorophenyl)(2-chloropyridin-3-yl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)-(2-chloro-3-pyridinyl)methanone (CAS 80099-85-0) is a chemical compound with the molecular formula C12H7Cl2NO and a molecular weight of 252.09 g/mol. IUPAC name: (4-chlorophenyl)-(2-chloro-3-pyridinyl)methanone. InChIKey: HIAWOLSEFDFMMY-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | (4-chlorophenyl)-(2-chloro-3-pyridinyl)methanone |
| InChIKey | HIAWOLSEFDFMMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)