CAS 62247-03-4 is the registry number for (3,4-Dichlorophenyl)(pyridin-3-yl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(3,4-dichlorophenyl)-pyridin-3-ylmethanone (CAS 62247-03-4) is a chemical compound with the molecular formula C12H7Cl2NO and a molecular weight of 252.09 g/mol. IUPAC name: (3,4-dichlorophenyl)-pyridin-3-ylmethanone. InChIKey: XTCRDAUMVZZCDC-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-pyridin-3-ylmethanone |
| InChIKey | XTCRDAUMVZZCDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)