CAS 34966-53-5 appears in our catalog under these names: Methyl 2-oxo-2-(p-tolyl)acetate, 97%, Methyl 2-(4-methylphenyl)-2-oxoacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
Methyl 2-(4-methylphenyl)-2-oxoacetate (CAS 34966-53-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2-(4-methylphenyl)-2-oxoacetate. InChIKey: IGFZBRICJIHTBI-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2-(4-methylphenyl)-2-oxoacetate |
| InChIKey | IGFZBRICJIHTBI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(=O)OC |
Computed by PubChem (NCBI)