CAS 349666-24-6 appears in our catalog under these names: Pyrenyl–1–boronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(pyren-1-yl)-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-pyren-1-yl-1,3,2-dioxaborolane, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
4,4,5,5-tetramethyl-2-pyren-1-yl-1,3,2-dioxaborolane (CAS 349666-24-6) is a chemical compound with the molecular formula C22H21BO2 and a molecular weight of 328.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pyren-1-yl-1,3,2-dioxaborolane. InChIKey: PHBXSUBZBOVYKO-UHFFFAOYSA-N.
| Molecular formula | C22H21BO2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pyren-1-yl-1,3,2-dioxaborolane |
| InChIKey | PHBXSUBZBOVYKO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC4=CC=CC5=C4C3=C(C=C2)C=C5 |
Computed by PubChem (NCBI)