CAS 853377-11-4 appears in our catalog under these names: 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrene, >98.0%(GC), 4,4,5,5-Tetramethyl-2-(pyren-2-yl)-1,3,2-dioxaborolane, 95%, 95%, 4,4,5,5-Tetramethyl-2-(pyren-2-yl)-1,3,2-dioxaborolane, 97%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-pyren-2-yl-1,3,2-dioxaborolane (CAS 853377-11-4) is a chemical compound with the molecular formula C22H21BO2 and a molecular weight of 328.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pyren-2-yl-1,3,2-dioxaborolane. InChIKey: PORWCBOPAQPLHP-UHFFFAOYSA-N.
| Molecular formula | C22H21BO2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pyren-2-yl-1,3,2-dioxaborolane |
| InChIKey | PORWCBOPAQPLHP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C4C(=C2)C=CC5=CC=CC(=C54)C=C3 |
Computed by PubChem (NCBI)