Products 863878-53-9

CAS 863878-53-9 is the registry number for Fluoranthene-3-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 863878-53-9) is a chemical compound with the molecular formula C22H21BO2 and a molecular weight of 328.2 g/mol. IUPAC name: 2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GECBKKNKRQJNCX-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21BO2
Molecular weight328.2 g/mol
IUPAC name2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyGECBKKNKRQJNCX-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=C4C3=C(C=C2)C5=CC=CC=C54

Computed by PubChem (NCBI)