CAS 863878-53-9 is the registry number for Fluoranthene-3-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 863878-53-9) is a chemical compound with the molecular formula C22H21BO2 and a molecular weight of 328.2 g/mol. IUPAC name: 2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GECBKKNKRQJNCX-UHFFFAOYSA-N.
| Molecular formula | C22H21BO2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-fluoranthen-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GECBKKNKRQJNCX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=C4C3=C(C=C2)C5=CC=CC=C54 |
Computed by PubChem (NCBI)