CAS 35022-68-5 appears in our catalog under these names: Paraquat Dipyridone, >95% (HPLC), Paraquat dipyridone, Paraquat dipyridone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 250mg, 1x10mg, 1x1ml.
1-methyl-4-(1-methyl-2-oxo-4-pyridinyl)pyridin-2-one (CAS 35022-68-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 1-methyl-4-(1-methyl-2-oxo-4-pyridinyl)pyridin-2-one. InChIKey: CTXBFNDTQFDFHL-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 1-methyl-4-(1-methyl-2-oxo-4-pyridinyl)pyridin-2-one |
| InChIKey | CTXBFNDTQFDFHL-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=CC1=O)C2=CC(=O)N(C=C2)C |
Computed by PubChem (NCBI)