CAS 35045-71-7 appears in our catalog under these names: L–Isoleucine–d10, L-Isoleucine-d10, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg, 10 mg.
(2S,3S)-2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid (CAS 35045-71-7) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 141.23 g/mol. IUPAC name: (2S,3S)-2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid. InChIKey: AGPKZVBTJJNPAG-VQWSQZATSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 141.23 g/mol |
| IUPAC name | (2S,3S)-2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-VQWSQZATSA-N |
| SMILES | [2H][C@@](C(=O)O)([C@@]([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])N |
Computed by PubChem (NCBI)