CAS 35098-52-3 appears in our catalog under these names: Corynecin II, Corynecin II. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 1 mg.
N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide (CAS 35098-52-3) is a chemical compound with the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. IUPAC name: N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide. InChIKey: LJMULVALRTTYIT-ZYHUDNBSSA-N.
| Molecular formula | C12H16N2O5 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
| InChIKey | LJMULVALRTTYIT-ZYHUDNBSSA-N |
| SMILES | CCC(=O)N[C@H](CO)[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)