CAS 350989-98-9 is the registry number for Methyl 2-amino-4-(2,4-dichlorophenyl)-5-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-amino-4-(2,4-dichlorophenyl)-5-methylthiophene-3-carboxylate (CAS 350989-98-9) is a chemical compound with the molecular formula C13H11Cl2NO2S and a molecular weight of 316.2 g/mol. IUPAC name: methyl 2-amino-4-(2,4-dichlorophenyl)-5-methylthiophene-3-carboxylate. InChIKey: KIJVPNHXXRFTSA-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | methyl 2-amino-4-(2,4-dichlorophenyl)-5-methylthiophene-3-carboxylate |
| InChIKey | KIJVPNHXXRFTSA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1)N)C(=O)OC)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)