CAS 351977-69-0 is the registry number for Ethyl 2-amino-4-(2,4-dichlorophenyl)thiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-amino-4-(2,4-dichlorophenyl)thiophene-3-carboxylate (CAS 351977-69-0) is a chemical compound with the molecular formula C13H11Cl2NO2S and a molecular weight of 316.2 g/mol. IUPAC name: ethyl 2-amino-4-(2,4-dichlorophenyl)thiophene-3-carboxylate. InChIKey: AOLLZSJHYLHEEI-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | ethyl 2-amino-4-(2,4-dichlorophenyl)thiophene-3-carboxylate |
| InChIKey | AOLLZSJHYLHEEI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)