Products 69951-04-8
CAS 69951-04-8 is the registry number for N-(2,3-dichlorophenyl)-4-methylbenzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(2,3-dichlorophenyl)-4-methylbenzenesulfonamide (CAS 69951-04-8) is a chemical compound with the molecular formula C13H11Cl2NO2S and a molecular weight of 316.2 g/mol. IUPAC name: N-(2,3-dichlorophenyl)-4-methylbenzenesulfonamide. InChIKey: WGUWVEMSOUZTMA-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | N-(2,3-dichlorophenyl)-4-methylbenzenesulfonamide |
| InChIKey | WGUWVEMSOUZTMA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)