Products 350999-95-0
CAS 350999-95-0 appears in our catalog under these names: 6-Bromo-2-(3-ethoxyphenyl)quinoline-4-carboxylic acid, 95%, 6-Bromo-2-(3-ethoxyphenyl)quinoline-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-bromo-2-(3-ethoxyphenyl)quinoline-4-carboxylic acid (CAS 350999-95-0) is a chemical compound with the molecular formula C18H14BrNO3 and a molecular weight of 372.2 g/mol. IUPAC name: 6-bromo-2-(3-ethoxyphenyl)quinoline-4-carboxylic acid. InChIKey: VNGWIIJCZIVDNZ-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO3 |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | 6-bromo-2-(3-ethoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | VNGWIIJCZIVDNZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O |
Computed by PubChem (NCBI)