CAS 78860-79-4 is the registry number for 4-(4-Bromophenyl)-2-indol-3-yl-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-bromophenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid (CAS 78860-79-4) is a chemical compound with the molecular formula C18H14BrNO3 and a molecular weight of 372.2 g/mol. IUPAC name: 4-(4-bromophenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid. InChIKey: UKZWMJMQQLWAET-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO3 |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| InChIKey | UKZWMJMQQLWAET-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CC(=O)C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)