CAS 354539-71-2 is the registry number for 6-Bromo-2-(4-ethoxyphenyl)-3-methyl-4-quinolinecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
6-bromo-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxylic acid (CAS 354539-71-2) is a chemical compound with the molecular formula C18H14BrNO3 and a molecular weight of 372.2 g/mol. IUPAC name: 6-bromo-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxylic acid. InChIKey: OIEVJPVQKZGMIA-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO3 |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | 6-bromo-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxylic acid |
| InChIKey | OIEVJPVQKZGMIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)Br)N=C1C3=CC=C(C=C3)OC)C(=O)O |
Computed by PubChem (NCBI)