Products 351325-30-9
CAS 351325-30-9 is the registry number for 5-Bromo-2-chloro-4-fluoro-benzoic acid ethyl ester, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 5-bromo-2-chloro-4-fluorobenzoate (CAS 351325-30-9) is a chemical compound with the molecular formula C9H7BrClFO2 and a molecular weight of 281.50 g/mol. IUPAC name: ethyl 5-bromo-2-chloro-4-fluorobenzoate. InChIKey: FXYKPLQYOKOXEB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO2 |
|---|---|
| Molecular weight | 281.50 g/mol |
| IUPAC name | ethyl 5-bromo-2-chloro-4-fluorobenzoate |
| InChIKey | FXYKPLQYOKOXEB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Cl)F)Br |
Computed by PubChem (NCBI)