CAS 35148-28-8 is the registry number for 4-O-Methyl-β-L-arabinopyranose. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
(2S,3R,4R,5S)-5-methoxyoxane-2,3,4-triol (CAS 35148-28-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4R,5S)-5-methoxyoxane-2,3,4-triol. InChIKey: VDTSWFBDTKNBSS-AZGQCCRYSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4R,5S)-5-methoxyoxane-2,3,4-triol |
| InChIKey | VDTSWFBDTKNBSS-AZGQCCRYSA-N |
| SMILES | CO[C@H]1CO[C@@H]([C@@H]([C@H]1O)O)O |
Computed by PubChem (NCBI)