Products 352431-26-6
CAS 352431-26-6 appears in our catalog under these names: Benzyl Benzoate-d12, Benzyl Benzoate-d12, 98 atom % D, min 98% Chemical Purity, Benzyl benzoate–d12, Benzyl benzoate-d12, 99.85%. Offered by: TRC, CDN, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 1mg, 10mg, 50mg.
[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 2,3,4,5,6-pentadeuteriobenzoate (CAS 352431-26-6) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 224.32 g/mol. IUPAC name: [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 2,3,4,5,6-pentadeuteriobenzoate. InChIKey: SESFRYSPDFLNCH-USINEXLCSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 2,3,4,5,6-pentadeuteriobenzoate |
| InChIKey | SESFRYSPDFLNCH-USINEXLCSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)OC([2H])([2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
orb3138356