CAS 352438-80-3 appears in our catalog under these names: Isoproturon-d3, >95% (HPLC), Isoproturon-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Isoproturon-d3, 99.81%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,05g, 0,01g, 10 mg, 5 mg, 1 mg.
1-methyl-3-(4-propan-2-ylphenyl)-1-(trideuteriomethyl)urea (CAS 352438-80-3) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 209.30 g/mol. IUPAC name: 1-methyl-3-(4-propan-2-ylphenyl)-1-(trideuteriomethyl)urea. InChIKey: PUIYMUZLKQOUOZ-HPRDVNIFSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 209.30 g/mol |
| IUPAC name | 1-methyl-3-(4-propan-2-ylphenyl)-1-(trideuteriomethyl)urea |
| InChIKey | PUIYMUZLKQOUOZ-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N(C)C(=O)NC1=CC=C(C=C1)C(C)C |
Computed by PubChem (NCBI)