CAS 352707-76-7 appears in our catalog under these names: Cis-Fmoc-2-Amino-1-cyclopentanecarboxylic acid, 96%, Fmoc-NH-cis-cyclopentane-COOH, (+/-)-Fmoc-cis-2-aminocyclopentane carboxylic acid, (+/-)-Fmoc-cis-2-aminocyclopentane carboxylic acid 95%, cis-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclopentanecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 0,25g, 2g, 100mg, 250mg.
Cis-(1R,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 352707-76-7) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: cis-(1R,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: KTLDVIJVCPIJCM-MJGOQNOKSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | cis-(1R,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | KTLDVIJVCPIJCM-MJGOQNOKSA-N |
| SMILES | C1C[C@H]([C@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)