CAS 359586-64-4 appears in our catalog under these names: (1S,2S)-Fmoc-2-aminocyclopentane carboxylic acid, 95%, (1S,2S)-Fmoc-acpc, >95% (HPLC), (1S,2S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)cyclopentanecarboxylic acid, Fmoc-ACPC-OH (1S,2S), Fmoc-(1S,2S)-2-aminocyclopentane carboxylic acid. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 2g, 25g, 10g.
Trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 359586-64-4) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: KTLDVIJVCPIJCM-HKUYNNGSSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | KTLDVIJVCPIJCM-HKUYNNGSSA-N |
| SMILES | C1C[C@@H]([C@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)