CAS 35306-75-3 is the registry number for 3-Bromo-N-isopropylbenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g.
3-bromo-N-propan-2-ylbenzamide (CAS 35306-75-3) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 3-bromo-N-propan-2-ylbenzamide. InChIKey: FRETYNHHZZBJMZ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 3-bromo-N-propan-2-ylbenzamide |
| InChIKey | FRETYNHHZZBJMZ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)