CAS 35310-80-6 is the registry number for 3-O-Demethyl-5,6-O-dimethylmalvone A. Offered by: TRC. Available pack sizes: 100mg.
4-hydroxy-7,8-dimethoxy-3-methylnaphthalene-1,2-dione (CAS 35310-80-6) is a chemical compound with the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. IUPAC name: 4-hydroxy-7,8-dimethoxy-3-methylnaphthalene-1,2-dione. InChIKey: WJQDJEHDPJCJSU-UHFFFAOYSA-N.
| Molecular formula | C13H12O5 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 4-hydroxy-7,8-dimethoxy-3-methylnaphthalene-1,2-dione |
| InChIKey | WJQDJEHDPJCJSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(=C(C=C2)OC)OC)C(=O)C1=O)O |
Computed by PubChem (NCBI)