CAS 35323-09-2 appears in our catalog under these names: 2-(2-Iodo-4,5-dimethoxyphenyl)acetic acid 97%, 2-(2-IODO-4,5-DIMETHOXYPHENYL)ACETIC ACID, 90%, 2-(2-Iodo-4,5-dimethoxyphenyl)acetic acid, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2-iodo-4,5-dimethoxyphenyl)acetic acid (CAS 35323-09-2) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: 2-(2-iodo-4,5-dimethoxyphenyl)acetic acid. InChIKey: MHGZTNSPOYJSRM-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | 2-(2-iodo-4,5-dimethoxyphenyl)acetic acid |
| InChIKey | MHGZTNSPOYJSRM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)I)OC |
Computed by PubChem (NCBI)