Products 65566-16-7

CAS 65566-16-7 is the registry number for Methyl 4-Iodo-3,5-dimethoxybenzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

Methyl 4-iodo-3,5-dimethoxybenzoate (CAS 65566-16-7) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: methyl 4-iodo-3,5-dimethoxybenzoate. InChIKey: MSACADVDOVUJQB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11IO4
Molecular weight322.10 g/mol
IUPAC namemethyl 4-iodo-3,5-dimethoxybenzoate
InChIKeyMSACADVDOVUJQB-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1I)OC)C(=O)OC

Computed by PubChem (NCBI)