CAS 59656-68-7 is the registry number for 1-(2-Hydroxy-3-iodo-4,6-dimethoxyphenyl)ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-hydroxy-3-iodo-4,6-dimethoxyphenyl)ethanone (CAS 59656-68-7) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: 1-(2-hydroxy-3-iodo-4,6-dimethoxyphenyl)ethanone. InChIKey: KYCCCHDGSOOVLE-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | 1-(2-hydroxy-3-iodo-4,6-dimethoxyphenyl)ethanone |
| InChIKey | KYCCCHDGSOOVLE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1OC)OC)I)O |
Computed by PubChem (NCBI)